Đăng Nhập / Đăng Ký
Thương hiệu: OEM

74-Piece Professional Drawing Pencils and Sketch Set Includes Colored Pencil Sketch Charcoal Pastel Pencil Sharpener

Size: 74pcs Art Set

Số Lượng

Hoàn tiền
111%
nếu giả
Mở hộp
kiểm tra
nhận hàng

Thông tin chi tiết

Thương hiệuOEM
Xuất xứ thương hiệuChina
Xuất xứchina

MÔ TẢ SẢN PHẨM

Features:
74pcs professional drawing kit, greatly meeting your different using needs. Comfortable grip, easy to color, giving you a smooth painting experience.
Includes 12 * Metallic Colored Pencil, 12 * Watercolor Pencils, 12 * Colored Pencil, 12 * Charcoal Pencil(Soft*4/Medium*4/Hard*4), 12 * Sketch Pencil(2H/3H/4H/5H/HB/B/2B/3B/4B/5B/6B/8B), 4 * Pastel Pencil, 3 * Paper Blending Stumps, 1 * Sandpaper Board, 1 * Eraser, 1 * Double Head Pencil Extender, 1 * Pencil Sharpener, 1 * Brush, 1 * Sketch Paper, 1 * Glove.
Ideal for drawing, sketching, doodling, painting and calligraphy. Ergonomic design, it can be painted for a long time without tiredness.
Equipped with a storage bag, which can protect each painting tool, easy to carry and store.
Suitable for children, beginners, school student, office worker, artists, art enthusiasts, etc.

Specifications:
Quantity: 74pcs Art Set
Storage Bag Size: 29.5 * 21.2 * 4.8cm / 11.6 * 8.3 * 1.9in

Packing List:
12 * Metallic Colored Pencil
12 * Watercolor Pencils
12 * Colored Pencil
12 * Charcoal Pencil(Soft*4/Medium*4/Hard*4)
12 * Sketch Pencil(2H/3H/4H/5H/HB/B/2B/3B/4B/5B/6B/8B)
4 * Pastel Pencil
3 * Paper Blending Stumps
1 * Sandpaper Board
1 * Eraser
1 * Double Head Pencil Extender
1 * Pencil Sharpener
1 * Brush
1 * Sketch Paper
1 * Glove












Giá sản phẩm trên Tiki đã bao gồm thuế theo luật hiện hành. Tuy nhiên tuỳ vào từng loại sản phẩm hoặc phương thức, địa chỉ giao hàng mà có thể phát sinh thêm chi phí khác như phí vận chuyển, phụ phí hàng cồng kềnh, .....